C53H82O6 — CID 134758206
[2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (8E,11E,14E)-heptadeca-8,11,14-trienoate (PubChem CID 134758206) has the molecular formula C53H82O6 and a molecular weight of 815.23 g/mol. Its IUPAC name is [2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (8E,11E,14E)-heptadeca-8,11,14-trienoate.
| Compound Name | [2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (8E,11E,14E)-heptadeca-8,11,14-trienoate |
|---|---|
| PubChem CID | 134758206 |
| Molecular Formula | C53H82O6 |
| Molecular Weight | 815.23 g/mol |
| Exact Mass | 814.61 |
| IUPAC Name | [2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (8E,11E,14E)-heptadeca-8,11,14-trienoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OCC(COC(=O)CCCCCC/C=C/C/C=C/C/C=C/CC)OC(=O)CCCCCC/C=C/C/C=C/C/C=C/CC |
| InChI | InChI=1S/C53H82O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-52(55)58-49-50(48-57-51(54)45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)59-53(56)47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h7-12,15-21,24-30,50H,4-6,13-14,22-23,31-49H2,1-3H3/b10-7+,11-8+,12-9+,18-15+,19-16+,20-17+,24-21+,28-25+,29-26+,30-27+ |
| InChIKey | PJPAVVCUUXSRAH-XWKQVNJFSA-N |
| XLogP | 14.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.23 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|