C46H70O6 — CID 138311559
[3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (7Z,9Z,11Z,13Z)-hexadeca-7,9,11,13-tetraenoate (PubChem CID 138311559) has the molecular formula C46H70O6 and a molecular weight of 719.06 g/mol. Its IUPAC name is [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (7Z,9Z,11Z,13Z)-hexadeca-7,9,11,13-tetraenoate.
| Compound Name | [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (7Z,9Z,11Z,13Z)-hexadeca-7,9,11,13-tetraenoate |
|---|---|
| PubChem CID | 138311559 |
| Molecular Formula | C46H70O6 |
| Molecular Weight | 719.06 g/mol |
| Exact Mass | 718.52 |
| IUPAC Name | [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (7Z,9Z,11Z,13Z)-hexadeca-7,9,11,13-tetraenoate |
| SMILES | CC/C=C\C=C/C=C\C=C/CCCCCC(=O)OCC(COC(=O)CCCC/C=C\C/C=C\CC)OC(=O)CCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C46H70O6/c1-4-7-10-13-16-19-21-23-25-27-30-33-36-39-45(48)51-42-43(41-50-44(47)38-35-32-29-26-18-15-12-9-6-3)52-46(49)40-37-34-31-28-24-22-20-17-14-11-8-5-2/h7-13,16-21,23-26,28,43H,4-6,14-15,22,27,29-42H2,1-3H3/b10-7-,11-8-,12-9-,16-13-,20-17-,21-19-,25-23-,26-18-,28-24- |
| InChIKey | ZDBKLFVUGRHHHR-VCHPMDDZSA-N |
| XLogP | 12.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.06 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|