C56H86O6 — CID 138267466
[1-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienoyl]oxy-3-[(7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoyl]oxypropan-2-yl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate (PubChem CID 138267466) has the molecular formula C56H86O6 and a molecular weight of 855.30 g/mol. Its IUPAC name is [1-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienoyl]oxy-3-[(7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoyl]oxypropan-2-yl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate.
| Compound Name | [1-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienoyl]oxy-3-[(7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoyl]oxypropan-2-yl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate |
|---|---|
| PubChem CID | 138267466 |
| Molecular Formula | C56H86O6 |
| Molecular Weight | 855.30 g/mol |
| Exact Mass | 854.64 |
| IUPAC Name | [1-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienoyl]oxy-3-[(7Z,9Z,11Z,13Z,15Z)-octadeca-7,9,11,13,15-pentaenoyl]oxypropan-2-yl] (11Z,13Z,15Z)-octadeca-11,13,15-trienoate |
| SMILES | CC/C=C\C=C/C=C\C=C/C=C\CCCCCC(=O)OCC(COC(=O)CCCCCC/C=C\C/C=C\C/C=C\CC)OC(=O)CCCCCCCCC/C=C\C=C/C=C\CC |
| InChI | InChI=1S/C56H86O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-53(51-60-54(57)48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h7-14,16-23,25,27-28,30-31,34,53H,4-6,15,24,26,29,32-33,35-52H2,1-3H3/b10-7-,11-8-,12-9-,16-13-,17-14-,21-18-,22-19-,23-20-,28-25-,30-27-,34-31- |
| InChIKey | TVXIYVQMGDJRIQ-NXVVGZRZSA-N |
| XLogP | 15.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.30 |
| LogP ≤ 5 | 15.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|