C15H14O7 — CID 54742421
[(2R)-2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] (E)-3-phenylprop-2-enoate (PubChem CID 54742421) has the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. Its IUPAC name is [(2R)-2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R)-2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 54742421 |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | [(2R)-2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OC[C@@H](O)C1OC(=O)C(O)=C1O |
| InChI | InChI=1S/C15H14O7/c16-10(14-12(18)13(19)15(20)22-14)8-21-11(17)7-6-9-4-2-1-3-5-9/h1-7,10,14,16,18-19H,8H2/b7-6+/t10-,14?/m1/s1 |
| InChIKey | UWHDHHFRIPSZIP-DHUBIWMWSA-N |
| XLogP | 0.86 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|