C17H18O9 — CID 66645191
[(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 66645191) has the molecular formula C17H18O9 and a molecular weight of 366.32 g/mol. Its IUPAC name is [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 66645191 |
| Molecular Formula | C17H18O9 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OC[C@H](O)[C@H]2OC(=O)C(O)=C2O)cc1OC |
| InChI | InChI=1S/C17H18O9/c1-23-11-5-3-9(7-12(11)24-2)4-6-13(19)25-8-10(18)16-14(20)15(21)17(22)26-16/h3-7,10,16,18,20-21H,8H2,1-2H3/t10-,16+/m0/s1 |
| InChIKey | COGSEIGSPASTBJ-MGPLVRAMSA-N |
| XLogP | 0.87 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|