C34H42O5S — CID 20764291
methyl 4-[8-methoxy-8-oxo-1-[2-(5-phenylpentoxy)phenyl]octan-3-yl]sulfanylbenzoate (PubChem CID 20764291) has the molecular formula C34H42O5S and a molecular weight of 562.77 g/mol. Its IUPAC name is methyl 4-[8-methoxy-8-oxo-1-[2-(5-phenylpentoxy)phenyl]octan-3-yl]sulfanylbenzoate.
| Compound Name | methyl 4-[8-methoxy-8-oxo-1-[2-(5-phenylpentoxy)phenyl]octan-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 20764291 |
| Molecular Formula | C34H42O5S |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | methyl 4-[8-methoxy-8-oxo-1-[2-(5-phenylpentoxy)phenyl]octan-3-yl]sulfanylbenzoate |
| SMILES | COC(=O)CCCCC(CCc1ccccc1OCCCCCc1ccccc1)Sc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C34H42O5S/c1-37-33(35)19-11-9-17-30(40-31-24-21-29(22-25-31)34(36)38-2)23-20-28-16-8-10-18-32(28)39-26-12-4-7-15-27-13-5-3-6-14-27/h3,5-6,8,10,13-14,16,18,21-22,24-25,30H,4,7,9,11-12,15,17,19-20,23,26H2,1-2H3 |
| InChIKey | KKLHOUOJJLNFLQ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|