C14H30O2S — CID 20765245
1-(2,2-dimethylpropylsulfonyl)-6,6-dimethylheptane (PubChem CID 20765245) has the molecular formula C14H30O2S and a molecular weight of 262.46 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylsulfonyl)-6,6-dimethylheptane.
| Compound Name | 1-(2,2-dimethylpropylsulfonyl)-6,6-dimethylheptane |
|---|---|
| PubChem CID | 20765245 |
| Molecular Formula | C14H30O2S |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 1-(2,2-dimethylpropylsulfonyl)-6,6-dimethylheptane |
| SMILES | CC(C)(C)CCCCCS(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C14H30O2S/c1-13(2,3)10-8-7-9-11-17(15,16)12-14(4,5)6/h7-12H2,1-6H3 |
| InChIKey | MAMHWDYYFMXBTA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|