C10H20O2S — CID 12635400
2,3-ditert-butylthiirane 1,1-dioxide (PubChem CID 12635400) has the molecular formula C10H20O2S and a molecular weight of 204.33 g/mol. Its IUPAC name is 2,3-ditert-butylthiirane 1,1-dioxide.
| Compound Name | 2,3-ditert-butylthiirane 1,1-dioxide |
|---|---|
| PubChem CID | 12635400 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2,3-ditert-butylthiirane 1,1-dioxide |
| SMILES | CC(C)(C)C1C(C(C)(C)C)S1(=O)=O |
| InChI | InChI=1S/C10H20O2S/c1-9(2,3)7-8(10(4,5)6)13(7,11)12/h7-8H,1-6H3 |
| InChIKey | CKZNBLBLDSKBBZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|