C45H54N4O — CID 20765914
N-(4-butoxyphenyl)-1-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]-N-[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine (PubChem CID 20765914) has the molecular formula C45H54N4O and a molecular weight of 666.95 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-1-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]-N-[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-(4-butoxyphenyl)-1-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]-N-[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 20765914 |
| Molecular Formula | C45H54N4O |
| Molecular Weight | 666.95 g/mol |
| Exact Mass | 666.43 |
| IUPAC Name | N-(4-butoxyphenyl)-1-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]-N-[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine |
| SMILES | CCCCOc1ccc(N(Cc2cncc(-c3cc(C)c(C)c(C)c3)c2)C2CCN(Cc3ccnc(-c4cc(C)c(C)c(C)c4)c3)CC2)cc1 |
| InChI | InChI=1S/C45H54N4O/c1-8-9-20-50-44-12-10-42(11-13-44)49(30-38-25-41(28-46-27-38)39-21-31(2)35(6)32(3)22-39)43-15-18-48(19-16-43)29-37-14-17-47-45(26-37)40-23-33(4)36(7)34(5)24-40/h10-14,17,21-28,43H,8-9,15-16,18-20,29-30H2,1-7H3 |
| InChIKey | OHAAJNKCZGHKCY-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.95 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|