C41H44F2N4 — CID 21352403
N-(3,4-difluorophenyl)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]-1-[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine (PubChem CID 21352403) has the molecular formula C41H44F2N4 and a molecular weight of 630.83 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]-1-[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-(3,4-difluorophenyl)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]-1-[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 21352403 |
| Molecular Formula | C41H44F2N4 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | N-(3,4-difluorophenyl)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]-1-[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine |
| SMILES | Cc1cc(-c2cncc(CN3CCC(N(Cc4ccnc(-c5cc(C)c(C)c(C)c5)c4)c4ccc(F)c(F)c4)CC3)c2)cc(C)c1C |
| InChI | InChI=1S/C41H44F2N4/c1-26-15-34(16-27(2)30(26)5)36-19-33(22-44-23-36)24-46-13-10-37(11-14-46)47(38-7-8-39(42)40(43)21-38)25-32-9-12-45-41(20-32)35-17-28(3)31(6)29(4)18-35/h7-9,12,15-23,37H,10-11,13-14,24-25H2,1-6H3 |
| InChIKey | ZTUGLDUZHWORMW-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |