C13H16O2 — CID 20765973
methyl 2-(5-methyl-2,3-dihydro-1H-inden-2-yl)acetate (PubChem CID 20765973) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is methyl 2-(5-methyl-2,3-dihydro-1H-inden-2-yl)acetate.
| Compound Name | methyl 2-(5-methyl-2,3-dihydro-1H-inden-2-yl)acetate |
|---|---|
| PubChem CID | 20765973 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | methyl 2-(5-methyl-2,3-dihydro-1H-inden-2-yl)acetate |
| SMILES | COC(=O)CC1Cc2ccc(C)cc2C1 |
| InChI | InChI=1S/C13H16O2/c1-9-3-4-11-6-10(7-12(11)5-9)8-13(14)15-2/h3-5,10H,6-8H2,1-2H3 |
| InChIKey | MDNFAIOAKKAOEA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |