methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate

C13H14O3 — CID 88794450

IUPACmethyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate
SMILESCOC(=O)Cc1ccc2c(c1)CC(C=O)C2
InChIInChI=1S/C13H14O3/c1-16-13(15)7-9-2-3-11-5-10(8-14)6-12(11)4-9/h2-4,8,10H,5-7H2,1H3
InChIKeyDZPVMANNPHQLIN-UHFFFAOYSA-N
MW218.25 g/mol
LogP1.32
Rot. Bonds3

About methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate

methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate (PubChem CID 88794450) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate
PubChem CID88794450
Molecular FormulaC13H14O3
Molecular Weight218.25 g/mol
Exact Mass218.09
IUPAC Namemethyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate
SMILESCOC(=O)Cc1ccc2c(c1)CC(C=O)C2
InChIInChI=1S/C13H14O3/c1-16-13(15)7-9-2-3-11-5-10(8-14)6-12(11)4-9/h2-4,8,10H,5-7H2,1H3
InChIKeyDZPVMANNPHQLIN-UHFFFAOYSA-N
XLogP1.32
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.25
LogP ≤ 51.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate?
The IUPAC name of methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate (CID 88794450) is methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate.
What is the SMILES notation for methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate?
The canonical SMILES for methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate is COC(=O)Cc1ccc2c(c1)CC(C=O)C2.
What is the InChIKey of methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate?
The InChIKey is DZPVMANNPHQLIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c1-16-13(15)7-9-2-3-11-5-10(8-14)6-12(11)4-9/h2-4,8,10H,5-7H2,1H3.
What are the key properties of methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate?
methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate has a molecular weight of 218.25 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-formyl-2,3-dihydro-1H-inden-5-yl)acetate is sourced from PubChem (CID 88794450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).