C28H44O5 — CID 20768609
[7,12-dihydroxy-10,13-dimethyl-17-(5-oxohexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] prop-2-enoate (PubChem CID 20768609) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is [7,12-dihydroxy-10,13-dimethyl-17-(5-oxohexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] prop-2-enoate.
| Compound Name | [7,12-dihydroxy-10,13-dimethyl-17-(5-oxohexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 20768609 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [7,12-dihydroxy-10,13-dimethyl-17-(5-oxohexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC2(C)C(C1)CC(O)C1C2CC(O)C2(C)C(C(C)CCC(C)=O)CCC12 |
| InChI | InChI=1S/C28H44O5/c1-6-25(32)33-19-11-12-27(4)18(13-19)14-23(30)26-21-10-9-20(16(2)7-8-17(3)29)28(21,5)24(31)15-22(26)27/h6,16,18-24,26,30-31H,1,7-15H2,2-5H3 |
| InChIKey | DMUBAERHJZBTTQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|