C27H44O5 — CID 59871801
[7,12-dihydroxy-17-(4-hydroxybutan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylprop-2-enoate (PubChem CID 59871801) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is [7,12-dihydroxy-17-(4-hydroxybutan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylprop-2-enoate.
| Compound Name | [7,12-dihydroxy-17-(4-hydroxybutan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59871801 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | [7,12-dihydroxy-17-(4-hydroxybutan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC2(C)C(C1)CC(O)C1C2CC(O)C2(C)C(C(C)CCO)CCC12 |
| InChI | InChI=1S/C27H44O5/c1-15(2)25(31)32-18-8-10-26(4)17(12-18)13-22(29)24-20-7-6-19(16(3)9-11-28)27(20,5)23(30)14-21(24)26/h16-24,28-30H,1,6-14H2,2-5H3 |
| InChIKey | GCNKNKPNLFBEGZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|