C12H11BN4OS2 — CID 20770457
CID 20770457 (PubChem CID 20770457) has the molecular formula C12H11BN4OS2 and a molecular weight of 302.19 g/mol.
| Compound Name | CID 20770457 |
|---|---|
| PubChem CID | 20770457 |
| Molecular Formula | C12H11BN4OS2 |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | — |
| SMILES | [B]SOCc1cc(CC)nc(Nc2ncc(C#N)s2)c1 |
| InChI | InChI=1S/C12H11BN4OS2/c1-2-9-3-8(7-18-20-13)4-11(16-9)17-12-15-6-10(5-14)19-12/h3-4,6H,2,7H2,1H3,(H,15,16,17) |
| InChIKey | ZXJUGTZOXORPDF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|