C16H18ClN5O2S2 — CID 58263737
tert-butyl 4-[4-chloro-6-[(5-cyano-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylbutanoate (PubChem CID 58263737) has the molecular formula C16H18ClN5O2S2 and a molecular weight of 411.94 g/mol. Its IUPAC name is tert-butyl 4-[4-chloro-6-[(5-cyano-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylbutanoate.
| Compound Name | tert-butyl 4-[4-chloro-6-[(5-cyano-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 58263737 |
| Molecular Formula | C16H18ClN5O2S2 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | tert-butyl 4-[4-chloro-6-[(5-cyano-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylbutanoate |
| SMILES | CC(C)(C)OC(=O)CCCSc1nc(Cl)cc(Nc2ncc(C#N)s2)n1 |
| InChI | InChI=1S/C16H18ClN5O2S2/c1-16(2,3)24-13(23)5-4-6-25-15-20-11(17)7-12(22-15)21-14-19-9-10(8-18)26-14/h7,9H,4-6H2,1-3H3,(H,19,20,21,22) |
| InChIKey | MDBSDGOGBMGTGI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|