C15H17ClN6O2S2 — CID 86653417
tert-butyl N-[2-[4-chloro-6-[(5-cyano-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylethyl]carbamate (PubChem CID 86653417) has the molecular formula C15H17ClN6O2S2 and a molecular weight of 412.93 g/mol. Its IUPAC name is tert-butyl N-[2-[4-chloro-6-[(5-cyano-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-chloro-6-[(5-cyano-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 86653417 |
| Molecular Formula | C15H17ClN6O2S2 |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | tert-butyl N-[2-[4-chloro-6-[(5-cyano-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSc1nc(Cl)cc(Nc2ncc(C#N)s2)n1 |
| InChI | InChI=1S/C15H17ClN6O2S2/c1-15(2,3)24-14(23)18-4-5-25-13-20-10(16)6-11(22-13)21-12-19-8-9(7-17)26-12/h6,8H,4-5H2,1-3H3,(H,18,23)(H,19,20,21,22) |
| InChIKey | SWPHAZNGZNEVNK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|