C18H28F3N3O — CID 20770582
2,2,2-trifluoro-N-methyl-N-[2-[4-(4-propoxyphenyl)piperazin-1-yl]ethyl]ethanamine (PubChem CID 20770582) has the molecular formula C18H28F3N3O and a molecular weight of 359.44 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[2-[4-(4-propoxyphenyl)piperazin-1-yl]ethyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[2-[4-(4-propoxyphenyl)piperazin-1-yl]ethyl]ethanamine |
|---|---|
| PubChem CID | 20770582 |
| Molecular Formula | C18H28F3N3O |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[2-[4-(4-propoxyphenyl)piperazin-1-yl]ethyl]ethanamine |
| SMILES | CCCOc1ccc(N2CCN(CCN(C)CC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C18H28F3N3O/c1-3-14-25-17-6-4-16(5-7-17)24-12-10-23(11-13-24)9-8-22(2)15-18(19,20)21/h4-7H,3,8-15H2,1-2H3 |
| InChIKey | DFBVOSCPAUXHBA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|