C16H28O2 — CID 20771626
1-(1-hydroperoxy-2,2-dimethylbutyl)adamantane (PubChem CID 20771626) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-(1-hydroperoxy-2,2-dimethylbutyl)adamantane.
| Compound Name | 1-(1-hydroperoxy-2,2-dimethylbutyl)adamantane |
|---|---|
| PubChem CID | 20771626 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 1-(1-hydroperoxy-2,2-dimethylbutyl)adamantane |
| SMILES | CCC(C)(C)C(OO)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H28O2/c1-4-15(2,3)14(18-17)16-8-11-5-12(9-16)7-13(6-11)10-16/h11-14,17H,4-10H2,1-3H3 |
| InChIKey | NHUZBVYLDQSVAS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|