About 3-hydroperoxy-2,4-dimethylhexane
3-hydroperoxy-2,4-dimethylhexane (PubChem CID 20771663) has the molecular formula C8H18O2
and a molecular weight of 146.23 g/mol. Its IUPAC name is 3-hydroperoxy-2,4-dimethylhexane.
Molecular Properties
| Compound Name | 3-hydroperoxy-2,4-dimethylhexane |
| PubChem CID | 20771663 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 3-hydroperoxy-2,4-dimethylhexane |
| SMILES | CCC(C)C(OO)C(C)C |
| InChI | InChI=1S/C8H18O2/c1-5-7(4)8(10-9)6(2)3/h6-9H,5H2,1-4H3 |
| InChIKey | TZEGTDSIVIQVST-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroperoxy-2,4-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroperoxy-2,4-dimethylhexane?
The IUPAC name of 3-hydroperoxy-2,4-dimethylhexane (CID 20771663) is 3-hydroperoxy-2,4-dimethylhexane.
What is the SMILES notation for 3-hydroperoxy-2,4-dimethylhexane?
The canonical SMILES for 3-hydroperoxy-2,4-dimethylhexane is CCC(C)C(OO)C(C)C.
What is the InChIKey of 3-hydroperoxy-2,4-dimethylhexane?
The InChIKey is TZEGTDSIVIQVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2/c1-5-7(4)8(10-9)6(2)3/h6-9H,5H2,1-4H3.
What are the key properties of 3-hydroperoxy-2,4-dimethylhexane?
3-hydroperoxy-2,4-dimethylhexane has a molecular weight of 146.23 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroperoxy-2,4-dimethylhexane is sourced from PubChem (CID 20771663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).