C16H20KN4O2P — CID 20772055
potassium 2-dimethylphosphoryl-N-[3-[(4-ethylpyrimidin-2-yl)amino]phenyl]acetamide (PubChem CID 20772055) has the molecular formula C16H20KN4O2P and a molecular weight of 370.43 g/mol. Its IUPAC name is potassium 2-dimethylphosphoryl-N-[3-[(4-ethylpyrimidin-2-yl)amino]phenyl]acetamide.
| Compound Name | potassium 2-dimethylphosphoryl-N-[3-[(4-ethylpyrimidin-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 20772055 |
| Molecular Formula | C16H20KN4O2P |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | potassium 2-dimethylphosphoryl-N-[3-[(4-ethylpyrimidin-2-yl)amino]phenyl]acetamide |
| SMILES | CCc1ccnc(Nc2cccc(NC(=O)[CH-]P(C)(C)=O)c2)n1.[K+] |
| InChI | InChI=1S/C16H20N4O2P.K/c1-4-12-8-9-17-16(19-12)20-14-7-5-6-13(10-14)18-15(21)11-23(2,3)22;/h5-11H,4H2,1-3H3,(H,18,21)(H,17,19,20);/q-1;+1 |
| InChIKey | ALHRWPUYSONNEY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|