C16H21N4O2P — CID 20772056
2-dimethylphosphoryl-N-[3-[(4-ethylpyrimidin-2-yl)amino]phenyl]acetamide (PubChem CID 20772056) has the molecular formula C16H21N4O2P and a molecular weight of 332.34 g/mol. Its IUPAC name is 2-dimethylphosphoryl-N-[3-[(4-ethylpyrimidin-2-yl)amino]phenyl]acetamide.
| Compound Name | 2-dimethylphosphoryl-N-[3-[(4-ethylpyrimidin-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 20772056 |
| Molecular Formula | C16H21N4O2P |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-dimethylphosphoryl-N-[3-[(4-ethylpyrimidin-2-yl)amino]phenyl]acetamide |
| SMILES | CCc1ccnc(Nc2cccc(NC(=O)CP(C)(C)=O)c2)n1 |
| InChI | InChI=1S/C16H21N4O2P/c1-4-12-8-9-17-16(19-12)20-14-7-5-6-13(10-14)18-15(21)11-23(2,3)22/h5-10H,4,11H2,1-3H3,(H,18,21)(H,17,19,20) |
| InChIKey | FJPRUSLVEQAWEX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|