C21H33ClN2O4S — CID 20774742
tert-butyl (2S)-2-[5-[(4-chlorophenyl)methylsulfonylamino]pentyl]pyrrolidine-1-carboxylate (PubChem CID 20774742) has the molecular formula C21H33ClN2O4S and a molecular weight of 445.03 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[(4-chlorophenyl)methylsulfonylamino]pentyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[(4-chlorophenyl)methylsulfonylamino]pentyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 20774742 |
| Molecular Formula | C21H33ClN2O4S |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | tert-butyl (2S)-2-[5-[(4-chlorophenyl)methylsulfonylamino]pentyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CCCCCNS(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H33ClN2O4S/c1-21(2,3)28-20(25)24-15-7-9-19(24)8-5-4-6-14-23-29(26,27)16-17-10-12-18(22)13-11-17/h10-13,19,23H,4-9,14-16H2,1-3H3/t19-/m0/s1 |
| InChIKey | UVLQPOBKUODKJV-IBGZPJMESA-N |
| XLogP | 4.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|