C23H23N3O8S3 — CID 20774815
3-[[5-[[(3,4-dihydroxyphenyl)sulfonylamino]methyl]thiophene-2-carbonyl]amino]-4-oxo-5-(pyridin-3-ylmethylsulfanyl)pentanoic acid (PubChem CID 20774815) has the molecular formula C23H23N3O8S3 and a molecular weight of 565.65 g/mol. Its IUPAC name is 3-[[5-[[(3,4-dihydroxyphenyl)sulfonylamino]methyl]thiophene-2-carbonyl]amino]-4-oxo-5-(pyridin-3-ylmethylsulfanyl)pentanoic acid.
| Compound Name | 3-[[5-[[(3,4-dihydroxyphenyl)sulfonylamino]methyl]thiophene-2-carbonyl]amino]-4-oxo-5-(pyridin-3-ylmethylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 20774815 |
| Molecular Formula | C23H23N3O8S3 |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 3-[[5-[[(3,4-dihydroxyphenyl)sulfonylamino]methyl]thiophene-2-carbonyl]amino]-4-oxo-5-(pyridin-3-ylmethylsulfanyl)pentanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(CNS(=O)(=O)c2ccc(O)c(O)c2)s1)C(=O)CSCc1cccnc1 |
| InChI | InChI=1S/C23H23N3O8S3/c27-18-5-4-16(8-19(18)28)37(33,34)25-11-15-3-6-21(36-15)23(32)26-17(9-22(30)31)20(29)13-35-12-14-2-1-7-24-10-14/h1-8,10,17,25,27-28H,9,11-13H2,(H,26,32)(H,30,31) |
| InChIKey | MUAOZPYOHZBJSK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 182.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|