C35H34N2O5S — CID 20780980
2-[[2-[4-[4-[(1-benzoylpiperidin-2-yl)methoxy]phenoxy]phenyl]ethanethioyl]-methylamino]benzoic acid (PubChem CID 20780980) has the molecular formula C35H34N2O5S and a molecular weight of 594.73 g/mol. Its IUPAC name is 2-[[2-[4-[4-[(1-benzoylpiperidin-2-yl)methoxy]phenoxy]phenyl]ethanethioyl]-methylamino]benzoic acid.
| Compound Name | 2-[[2-[4-[4-[(1-benzoylpiperidin-2-yl)methoxy]phenoxy]phenyl]ethanethioyl]-methylamino]benzoic acid |
|---|---|
| PubChem CID | 20780980 |
| Molecular Formula | C35H34N2O5S |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 2-[[2-[4-[4-[(1-benzoylpiperidin-2-yl)methoxy]phenoxy]phenyl]ethanethioyl]-methylamino]benzoic acid |
| SMILES | CN(C(=S)Cc1ccc(Oc2ccc(OCC3CCCCN3C(=O)c3ccccc3)cc2)cc1)c1ccccc1C(=O)O |
| InChI | InChI=1S/C35H34N2O5S/c1-36(32-13-6-5-12-31(32)35(39)40)33(43)23-25-14-16-29(17-15-25)42-30-20-18-28(19-21-30)41-24-27-11-7-8-22-37(27)34(38)26-9-3-2-4-10-26/h2-6,9-10,12-21,27H,7-8,11,22-24H2,1H3,(H,39,40) |
| InChIKey | KMOOBWPXKCOOKH-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|