C8H15N — CID 20781284
5-butan-2-yl-2,3-dihydro-1H-pyrrole (PubChem CID 20781284) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is 5-butan-2-yl-2,3-dihydro-1H-pyrrole.
| Compound Name | 5-butan-2-yl-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 20781284 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 5-butan-2-yl-2,3-dihydro-1H-pyrrole |
| SMILES | CCC(C)C1=CCCN1 |
| InChI | InChI=1S/C8H15N/c1-3-7(2)8-5-4-6-9-8/h5,7,9H,3-4,6H2,1-2H3 |
| InChIKey | TVDJLQBBMRBOMZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |