C20H22N2O6 — CID 20782085
N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-1-benzofuran-6-carboxamide;(E)-but-2-enedioic acid (PubChem CID 20782085) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-1-benzofuran-6-carboxamide;(E)-but-2-enedioic acid.
| Compound Name | N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-1-benzofuran-6-carboxamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 20782085 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-1-benzofuran-6-carboxamide;(E)-but-2-enedioic acid |
| SMILES | O=C(N[C@@H]1C[C@H]2CCN(C2)C1)c1ccc2ccoc2c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H18N2O2.C4H4O4/c19-16(13-2-1-12-4-6-20-15(12)8-13)17-14-7-11-3-5-18(9-11)10-14;5-3(6)1-2-4(7)8/h1-2,4,6,8,11,14H,3,5,7,9-10H2,(H,17,19);1-2H,(H,5,6)(H,7,8)/b;2-1+/t11-,14-;/m1./s1 |
| InChIKey | RQFIXHHGVIJSCA-QXZRRXKDSA-N |
| XLogP | 1.97 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|