C15H16ClN3O2 — CID 87166112
N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-7-chlorofuro[2,3-c]pyridine-5-carboxamide (PubChem CID 87166112) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-7-chlorofuro[2,3-c]pyridine-5-carboxamide.
| Compound Name | N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-7-chlorofuro[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 87166112 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-7-chlorofuro[2,3-c]pyridine-5-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CCN(C2)C1)c1cc2ccoc2c(Cl)n1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-14-13-10(2-4-21-13)6-12(18-14)15(20)17-11-5-9-1-3-19(7-9)8-11/h2,4,6,9,11H,1,3,5,7-8H2,(H,17,20)/t9-,11-/m1/s1 |
| InChIKey | REENQZUMJKLTTI-MWLCHTKSSA-N |
| XLogP | 2.31 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|