C13H16ClN3O2 — CID 87940296
N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-6-chloro-5-hydroxypyridine-2-carboxamide (PubChem CID 87940296) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-6-chloro-5-hydroxypyridine-2-carboxamide.
| Compound Name | N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-6-chloro-5-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 87940296 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-[(3R,5R)-1-azabicyclo[3.2.1]octan-3-yl]-6-chloro-5-hydroxypyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CCN(C2)C1)c1ccc(O)c(Cl)n1 |
| InChI | InChI=1S/C13H16ClN3O2/c14-12-11(18)2-1-10(16-12)13(19)15-9-5-8-3-4-17(6-8)7-9/h1-2,8-9,18H,3-7H2,(H,15,19)/t8-,9-/m1/s1 |
| InChIKey | DCRBFXSMQLZRIZ-RKDXNWHRSA-N |
| XLogP | 1.26 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|