C12H15ClN4O2 — CID 22243235
N-(1-azabicyclo[3.2.1]octan-3-yl)-4-chloro-5-hydroxypyrimidine-2-carboxamide (PubChem CID 22243235) has the molecular formula C12H15ClN4O2 and a molecular weight of 282.73 g/mol. Its IUPAC name is N-(1-azabicyclo[3.2.1]octan-3-yl)-4-chloro-5-hydroxypyrimidine-2-carboxamide.
| Compound Name | N-(1-azabicyclo[3.2.1]octan-3-yl)-4-chloro-5-hydroxypyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 22243235 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-(1-azabicyclo[3.2.1]octan-3-yl)-4-chloro-5-hydroxypyrimidine-2-carboxamide |
| SMILES | O=C(NC1CC2CCN(C2)C1)c1ncc(O)c(Cl)n1 |
| InChI | InChI=1S/C12H15ClN4O2/c13-10-9(18)4-14-11(16-10)12(19)15-8-3-7-1-2-17(5-7)6-8/h4,7-8,18H,1-3,5-6H2,(H,15,19) |
| InChIKey | MVXRLCQBTTUFEL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |