C26H38O5 — CID 20783105
3-[4-(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl)-3-oxobutan-2-yl]-4-(3-methyloxan-2-yl)oxolane-2,5-dione (PubChem CID 20783105) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is 3-[4-(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl)-3-oxobutan-2-yl]-4-(3-methyloxan-2-yl)oxolane-2,5-dione.
| Compound Name | 3-[4-(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl)-3-oxobutan-2-yl]-4-(3-methyloxan-2-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 20783105 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 3-[4-(8-ethyl-8-tricyclo[5.2.1.02,6]decanyl)-3-oxobutan-2-yl]-4-(3-methyloxan-2-yl)oxolane-2,5-dione |
| SMILES | CCC1(CC(=O)C(C)C2C(=O)OC(=O)C2C2OCCCC2C)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C26H38O5/c1-4-26(12-16-11-19(26)18-9-5-8-17(16)18)13-20(27)15(3)21-22(25(29)31-24(21)28)23-14(2)7-6-10-30-23/h14-19,21-23H,4-13H2,1-3H3 |
| InChIKey | MYICEIKZBSZZHK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|