C17H12F6NO+ — CID 20783339
3-[2,4-bis(trifluoromethyl)phenyl]-8-methyl-2H-1,3-benzoxazin-3-ium (PubChem CID 20783339) has the molecular formula C17H12F6NO+ and a molecular weight of 360.28 g/mol. Its IUPAC name is 3-[2,4-bis(trifluoromethyl)phenyl]-8-methyl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 3-[2,4-bis(trifluoromethyl)phenyl]-8-methyl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 20783339 |
| Molecular Formula | C17H12F6NO+ |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-[2,4-bis(trifluoromethyl)phenyl]-8-methyl-2H-1,3-benzoxazin-3-ium |
| SMILES | Cc1cccc2c1OC[N+](c1ccc(C(F)(F)F)cc1C(F)(F)F)=C2 |
| InChI | InChI=1S/C17H12F6NO/c1-10-3-2-4-11-8-24(9-25-15(10)11)14-6-5-12(16(18,19)20)7-13(14)17(21,22)23/h2-8H,9H2,1H3/q+1 |
| InChIKey | XRSZNFZNPXUTLU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|