C15H18NO2+ — CID 20783606
3-cyclohexyl-6-methyl-1,3-benzoxazin-3-ium-2-one (PubChem CID 20783606) has the molecular formula C15H18NO2+ and a molecular weight of 244.31 g/mol. Its IUPAC name is 3-cyclohexyl-6-methyl-1,3-benzoxazin-3-ium-2-one.
| Compound Name | 3-cyclohexyl-6-methyl-1,3-benzoxazin-3-ium-2-one |
|---|---|
| PubChem CID | 20783606 |
| Molecular Formula | C15H18NO2+ |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-cyclohexyl-6-methyl-1,3-benzoxazin-3-ium-2-one |
| SMILES | Cc1ccc2oc(=O)[n+](C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C15H18NO2/c1-11-7-8-14-12(9-11)10-16(15(17)18-14)13-5-3-2-4-6-13/h7-10,13H,2-6H2,1H3/q+1 |
| InChIKey | KAQKXXJWBHLXOO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|