C11H22N3Ni — CID 20791687
1-ethyl-5-methyl-1,2,4-triazole;nickel(3+);propane (PubChem CID 20791687) has the molecular formula C11H22N3Ni and a molecular weight of 255.01 g/mol. Its IUPAC name is 1-ethyl-5-methyl-1,2,4-triazole;nickel(3+);propane.
| Compound Name | 1-ethyl-5-methyl-1,2,4-triazole;nickel(3+);propane |
|---|---|
| PubChem CID | 20791687 |
| Molecular Formula | C11H22N3Ni |
| Molecular Weight | 255.01 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-ethyl-5-methyl-1,2,4-triazole;nickel(3+);propane |
| SMILES | [CH2-]CC.[CH2-]CC.[CH2-]Cn1ncnc1C.[Ni+3] |
| InChI | InChI=1S/C5H8N3.2C3H7.Ni/c1-3-8-5(2)6-4-7-8;2*1-3-2;/h4H,1,3H2,2H3;2*1,3H2,2H3;/q3*-1;+3 |
| InChIKey | CJCLTSKBUPZNEI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.01 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|