C4H6FN3 — CID 59330599
3-(fluoromethyl)-1-methyl-1,2,4-triazole (PubChem CID 59330599) has the molecular formula C4H6FN3 and a molecular weight of 115.11 g/mol. Its IUPAC name is 3-(fluoromethyl)-1-methyl-1,2,4-triazole.
| Compound Name | 3-(fluoromethyl)-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 59330599 |
| Molecular Formula | C4H6FN3 |
| Molecular Weight | 115.11 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | 3-(fluoromethyl)-1-methyl-1,2,4-triazole |
| SMILES | Cn1cnc(CF)n1 |
| InChI | InChI=1S/C4H6FN3/c1-8-3-6-4(2-5)7-8/h3H,2H2,1H3 |
| InChIKey | OIHZYVDXRANSRN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.11 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |