C16H24N2O4 — CID 20793429
2-(2,2-dimethylbutanoylamino)-5-(ethoxymethylamino)benzoic acid (PubChem CID 20793429) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoylamino)-5-(ethoxymethylamino)benzoic acid.
| Compound Name | 2-(2,2-dimethylbutanoylamino)-5-(ethoxymethylamino)benzoic acid |
|---|---|
| PubChem CID | 20793429 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-(2,2-dimethylbutanoylamino)-5-(ethoxymethylamino)benzoic acid |
| SMILES | CCOCNc1ccc(NC(=O)C(C)(C)CC)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-5-16(3,4)15(21)18-13-8-7-11(17-10-22-6-2)9-12(13)14(19)20/h7-9,17H,5-6,10H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | PUSCKTNSTLADIZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|