C27H34N4O5 — CID 20794072
2-[[1-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 20794072) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-[[1-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 2-[[1-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 20794072 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-[[1-[2-[4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)C1CCCN1C(=O)Cc1ccc(NC(=O)Nc2ccccc2C)cc1)C(=O)O |
| InChI | InChI=1S/C27H34N4O5/c1-3-4-9-22(26(34)35)29-25(33)23-11-7-16-31(23)24(32)17-19-12-14-20(15-13-19)28-27(36)30-21-10-6-5-8-18(21)2/h5-6,8,10,12-15,22-23H,3-4,7,9,11,16-17H2,1-2H3,(H,29,33)(H,34,35)(H2,28,30,36) |
| InChIKey | VZUAJSIFXIWEEF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |