C13H14N3O3Y+2 — CID 20794343
ethyl 8-ethyl-3-methanidyl-5-oxopyrido[2,3-c]pyridazine-6-carboxylate;yttrium(3+) (PubChem CID 20794343) has the molecular formula C13H14N3O3Y+2 and a molecular weight of 349.18 g/mol. Its IUPAC name is ethyl 8-ethyl-3-methanidyl-5-oxopyrido[2,3-c]pyridazine-6-carboxylate;yttrium(3+).
| Compound Name | ethyl 8-ethyl-3-methanidyl-5-oxopyrido[2,3-c]pyridazine-6-carboxylate;yttrium(3+) |
|---|---|
| PubChem CID | 20794343 |
| Molecular Formula | C13H14N3O3Y+2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | ethyl 8-ethyl-3-methanidyl-5-oxopyrido[2,3-c]pyridazine-6-carboxylate;yttrium(3+) |
| SMILES | [CH2-]c1cc2c(=O)c(C(=O)OCC)cn(CC)c2nn1.[Y+3] |
| InChI | InChI=1S/C13H14N3O3.Y/c1-4-16-7-10(13(18)19-5-2)11(17)9-6-8(3)14-15-12(9)16;/h6-7H,3-5H2,1-2H3;/q-1;+3 |
| InChIKey | DLBAZUNVDHDGHX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|