C31H55B2N7O14P2S — CID 20798602
CID 20798602 (PubChem CID 20798602) has the molecular formula C31H55B2N7O14P2S and a molecular weight of 865.45 g/mol.
| Compound Name | CID 20798602 |
|---|---|
| PubChem CID | 20798602 |
| Molecular Formula | C31H55B2N7O14P2S |
| Molecular Weight | 865.45 g/mol |
| Exact Mass | 865.32 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)N(CCNC(=O)CN(CCOP(=O)(O)OCCCCCCCNC(=O)CCCCC1SCC2NC(=O)NC21)C(=O)C[B])CC(=O)NCCOP(=O)(O)O |
| InChI | InChI=1S/C31H55B2N7O14P2S/c32-18-28(44)39(20-27(43)36-12-16-52-55(47,48)49)13-11-35-26(42)21-40(29(45)19-33)14-17-54-56(50,51)53-15-7-3-1-2-6-10-34-25(41)9-5-4-8-24-30-23(22-57-24)37-31(46)38-30/h23-24,30H,1-22H2,(H,34,41)(H,35,42)(H,36,43)(H,50,51)(H2,37,38,46)(H2,47,48,49) |
| InChIKey | NSCNDMMFYORTIF-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 291.57 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.45 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|