C16H19N3O2 — CID 20798969
3-(methylamino)-1-(1,3-oxazol-2-yl)-7-phenylazepan-2-one (PubChem CID 20798969) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-(methylamino)-1-(1,3-oxazol-2-yl)-7-phenylazepan-2-one.
| Compound Name | 3-(methylamino)-1-(1,3-oxazol-2-yl)-7-phenylazepan-2-one |
|---|---|
| PubChem CID | 20798969 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-(methylamino)-1-(1,3-oxazol-2-yl)-7-phenylazepan-2-one |
| SMILES | CNC1CCCC(c2ccccc2)N(c2ncco2)C1=O |
| InChI | InChI=1S/C16H19N3O2/c1-17-13-8-5-9-14(12-6-3-2-4-7-12)19(15(13)20)16-18-10-11-21-16/h2-4,6-7,10-11,13-14,17H,5,8-9H2,1H3 |
| InChIKey | LVLCMTPNNJJEQY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |