C13H11O5- — CID 20801187
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl octa-4,6-diynoate (PubChem CID 20801187) has the molecular formula C13H11O5- and a molecular weight of 247.23 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl octa-4,6-diynoate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl octa-4,6-diynoate |
|---|---|
| PubChem CID | 20801187 |
| Molecular Formula | C13H11O5- |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl octa-4,6-diynoate |
| SMILES | CC#CC#C[CH-]CC(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C13H11O5/c1-3-4-5-6-7-8-12(14)16-9-11-10(2)17-13(15)18-11/h7H,8-9H2,1-2H3/q-1 |
| InChIKey | ZMAKUERSQPHWJJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|