C10H17N2O+ — CID 20802811
1-[1-(3-aminopropyl)pyridin-1-ium-4-yl]ethanol (PubChem CID 20802811) has the molecular formula C10H17N2O+ and a molecular weight of 181.26 g/mol. Its IUPAC name is 1-[1-(3-aminopropyl)pyridin-1-ium-4-yl]ethanol.
| Compound Name | 1-[1-(3-aminopropyl)pyridin-1-ium-4-yl]ethanol |
|---|---|
| PubChem CID | 20802811 |
| Molecular Formula | C10H17N2O+ |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-[1-(3-aminopropyl)pyridin-1-ium-4-yl]ethanol |
| SMILES | CC(O)c1cc[n+](CCCN)cc1 |
| InChI | InChI=1S/C10H17N2O/c1-9(13)10-3-7-12(8-4-10)6-2-5-11/h3-4,7-9,13H,2,5-6,11H2,1H3/q+1 |
| InChIKey | NOCLLGKQXFBSDO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 50.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|