C20H30N6O2+2 — CID 53310355
[2-(carbamoylamino)-1,2-bis(1-propylpyridin-1-ium-4-yl)ethyl]urea (PubChem CID 53310355) has the molecular formula C20H30N6O2+2 and a molecular weight of 386.50 g/mol. Its IUPAC name is [2-(carbamoylamino)-1,2-bis(1-propylpyridin-1-ium-4-yl)ethyl]urea.
| Compound Name | [2-(carbamoylamino)-1,2-bis(1-propylpyridin-1-ium-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 53310355 |
| Molecular Formula | C20H30N6O2+2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | [2-(carbamoylamino)-1,2-bis(1-propylpyridin-1-ium-4-yl)ethyl]urea |
| SMILES | CCC[n+]1ccc(C(NC(N)=O)C(NC(N)=O)c2cc[n+](CCC)cc2)cc1 |
| InChI | InChI=1S/C20H28N6O2/c1-3-9-25-11-5-15(6-12-25)17(23-19(21)27)18(24-20(22)28)16-7-13-26(10-4-2)14-8-16/h5-8,11-14,17-18H,3-4,9-10H2,1-2H3,(H4-2,21,22,23,24,27,28)/p+2 |
| InChIKey | SUKRERKVYRVZAI-UHFFFAOYSA-P |
| XLogP | 1.20 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|