C18H26N6O2+2 — CID 53310235
[2-(carbamoylamino)-1,2-bis(1-ethylpyridin-1-ium-4-yl)ethyl]urea (PubChem CID 53310235) has the molecular formula C18H26N6O2+2 and a molecular weight of 358.45 g/mol. Its IUPAC name is [2-(carbamoylamino)-1,2-bis(1-ethylpyridin-1-ium-4-yl)ethyl]urea.
| Compound Name | [2-(carbamoylamino)-1,2-bis(1-ethylpyridin-1-ium-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 53310235 |
| Molecular Formula | C18H26N6O2+2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [2-(carbamoylamino)-1,2-bis(1-ethylpyridin-1-ium-4-yl)ethyl]urea |
| SMILES | CC[n+]1ccc(C(NC(N)=O)C(NC(N)=O)c2cc[n+](CC)cc2)cc1 |
| InChI | InChI=1S/C18H24N6O2/c1-3-23-9-5-13(6-10-23)15(21-17(19)25)16(22-18(20)26)14-7-11-24(4-2)12-8-14/h5-12,15-16H,3-4H2,1-2H3,(H4-2,19,20,21,22,25,26)/p+2 |
| InChIKey | AQRWEOCNMWHIAI-UHFFFAOYSA-P |
| XLogP | 0.42 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|