C16H20N3O+ — CID 145389532
4-amino-N-[2-(1-ethylpyridin-1-ium-4-yl)ethyl]benzamide (PubChem CID 145389532) has the molecular formula C16H20N3O+ and a molecular weight of 270.36 g/mol. Its IUPAC name is 4-amino-N-[2-(1-ethylpyridin-1-ium-4-yl)ethyl]benzamide.
| Compound Name | 4-amino-N-[2-(1-ethylpyridin-1-ium-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 145389532 |
| Molecular Formula | C16H20N3O+ |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4-amino-N-[2-(1-ethylpyridin-1-ium-4-yl)ethyl]benzamide |
| SMILES | CC[n+]1ccc(CCNC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C16H19N3O/c1-2-19-11-8-13(9-12-19)7-10-18-16(20)14-3-5-15(17)6-4-14/h3-6,8-9,11-12H,2,7,10H2,1H3,(H2-,17,18,20)/p+1 |
| InChIKey | CMCRVNADJDKGOK-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|