C22H17N5O4 — CID 20806037
4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]isoindole-1,3-dione (PubChem CID 20806037) has the molecular formula C22H17N5O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is 4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]isoindole-1,3-dione.
| Compound Name | 4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 20806037 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2cc3nccn3c(Nc3cccc4c3C(=O)NC4=O)n2)cc1OC |
| InChI | InChI=1S/C22H17N5O4/c1-30-16-7-6-12(10-17(16)31-2)15-11-18-23-8-9-27(18)22(25-15)24-14-5-3-4-13-19(14)21(29)26-20(13)28/h3-11H,1-2H3,(H,24,25)(H,26,28,29) |
| InChIKey | OBYUFWHHWLZFPE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|