About chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine
chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 20807146) has the molecular formula C10H6ClF3IrN3O
and a molecular weight of 468.84 g/mol. Its IUPAC name is chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
Molecular Properties
| Compound Name | chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| PubChem CID | 20807146 |
| Molecular Formula | C10H6ClF3IrN3O |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | Cl[Ir+2].FC(F)(F)c1cc(-c2ccccn2)[n-]n1.[CH-]=O |
| InChI | InChI=1S/C9H5F3N3.CHO.ClH.Ir/c10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;1-2;;/h1-5H;1H;1H;/q2*-1;;+3/p-1 |
| InChIKey | CMERHWYISNCJFK-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 56.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine?
The IUPAC name of chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (CID 20807146) is chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
What is the SMILES notation for chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine?
The canonical SMILES for chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine is Cl[Ir+2].FC(F)(F)c1cc(-c2ccccn2)[n-]n1.[CH-]=O.
What is the InChIKey of chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine?
The InChIKey is CMERHWYISNCJFK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H5F3N3.CHO.ClH.Ir/c10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;1-2;;/h1-5H;1H;1H;/q2*-1;;+3/p-1.
What are the key properties of chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine?
chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine has a molecular weight of 468.84 g/mol, XLogP of 2.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloroiridium(2+);methanone;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine is sourced from PubChem (CID 20807146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).