C23H27ClF2 — CID 20808240
3-[(6R,8aR)-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-chloro-1,6-difluoronaphthalene (PubChem CID 20808240) has the molecular formula C23H27ClF2 and a molecular weight of 376.92 g/mol. Its IUPAC name is 3-[(6R,8aR)-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-chloro-1,6-difluoronaphthalene.
| Compound Name | 3-[(6R,8aR)-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-chloro-1,6-difluoronaphthalene |
|---|---|
| PubChem CID | 20808240 |
| Molecular Formula | C23H27ClF2 |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-[(6R,8aR)-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-chloro-1,6-difluoronaphthalene |
| SMILES | CCC[C@@H]1CC[C@@H]2CC(c3cc(F)c4cc(Cl)c(F)cc4c3)CCC2C1 |
| InChI | InChI=1S/C23H27ClF2/c1-2-3-14-4-5-16-9-17(7-6-15(16)8-14)18-10-19-12-23(26)21(24)13-20(19)22(25)11-18/h10-17H,2-9H2,1H3/t14-,15?,16-,17?/m1/s1 |
| InChIKey | OLYJGJFKSGTAHS-KZYLPZIUSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |