C10H14S — CID 2081007
2,3,5,6-tetramethylbenzenethiol (PubChem CID 2081007) has the molecular formula C10H14S and a molecular weight of 166.29 g/mol. Its IUPAC name is 2,3,5,6-tetramethylbenzenethiol.
| Compound Name | 2,3,5,6-tetramethylbenzenethiol |
|---|---|
| PubChem CID | 2081007 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 2,3,5,6-tetramethylbenzenethiol |
| SMILES | Cc1cc(C)c(C)c(S)c1C |
| InChI | InChI=1S/C10H14S/c1-6-5-7(2)9(4)10(11)8(6)3/h5,11H,1-4H3 |
| InChIKey | LSBHSNREDVBEMQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|