C23H21ClN4O4 — CID 20810394
N-[4-chloro-3-[[3-(4-methoxyphenyl)-3-oxo-2-pyrazol-1-ylpropanoyl]amino]phenyl]-2-methylprop-2-enamide (PubChem CID 20810394) has the molecular formula C23H21ClN4O4 and a molecular weight of 452.90 g/mol. Its IUPAC name is N-[4-chloro-3-[[3-(4-methoxyphenyl)-3-oxo-2-pyrazol-1-ylpropanoyl]amino]phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[4-chloro-3-[[3-(4-methoxyphenyl)-3-oxo-2-pyrazol-1-ylpropanoyl]amino]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 20810394 |
| Molecular Formula | C23H21ClN4O4 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[4-chloro-3-[[3-(4-methoxyphenyl)-3-oxo-2-pyrazol-1-ylpropanoyl]amino]phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(Cl)c(NC(=O)C(C(=O)c2ccc(OC)cc2)n2cccn2)c1 |
| InChI | InChI=1S/C23H21ClN4O4/c1-14(2)22(30)26-16-7-10-18(24)19(13-16)27-23(31)20(28-12-4-11-25-28)21(29)15-5-8-17(32-3)9-6-15/h4-13,20H,1H2,2-3H3,(H,26,30)(H,27,31) |
| InChIKey | YOEYOERZYPKUOH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|